C12H7F8O3S- — CID 154467531
8-methyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 154467531) has the molecular formula C12H7F8O3S- and a molecular weight of 383.24 g/mol. Its IUPAC name is 8-methyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 8-methyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 154467531 |
| Molecular Formula | C12H7F8O3S- |
| Molecular Weight | 383.24 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | 8-methyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | Cc1cc(S(F)(F)(F)(F)F)cc2c1OC(C(F)(F)F)C(C(=O)[O-])=C2 |
| InChI | InChI=1S/C12H8F8O3S/c1-5-2-7(24(16,17,18,19)20)3-6-4-8(11(21)22)10(12(13,14)15)23-9(5)6/h2-4,10H,1H3,(H,21,22)/p-1 |
| InChIKey | XGLBAOPSVHPQDV-UHFFFAOYSA-M |
| XLogP | 4.11 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.24 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |