About 1-hydroxy-3,4-dimethylimidazolidin-2-one
1-hydroxy-3,4-dimethylimidazolidin-2-one (PubChem CID 154468014) has the molecular formula C5H10N2O2
and a molecular weight of 130.15 g/mol. Its IUPAC name is 1-hydroxy-3,4-dimethylimidazolidin-2-one.
Molecular Properties
| Compound Name | 1-hydroxy-3,4-dimethylimidazolidin-2-one |
| PubChem CID | 154468014 |
| Molecular Formula | C5H10N2O2 |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.07 |
| IUPAC Name | 1-hydroxy-3,4-dimethylimidazolidin-2-one |
| SMILES | CC1CN(O)C(=O)N1C |
| InChI | InChI=1S/C5H10N2O2/c1-4-3-7(9)5(8)6(4)2/h4,9H,3H2,1-2H3 |
| InChIKey | UXDZUYPDHZUACW-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-3,4-dimethylimidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-3,4-dimethylimidazolidin-2-one?
The IUPAC name of 1-hydroxy-3,4-dimethylimidazolidin-2-one (CID 154468014) is 1-hydroxy-3,4-dimethylimidazolidin-2-one.
What is the SMILES notation for 1-hydroxy-3,4-dimethylimidazolidin-2-one?
The canonical SMILES for 1-hydroxy-3,4-dimethylimidazolidin-2-one is CC1CN(O)C(=O)N1C.
What is the InChIKey of 1-hydroxy-3,4-dimethylimidazolidin-2-one?
The InChIKey is UXDZUYPDHZUACW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O2/c1-4-3-7(9)5(8)6(4)2/h4,9H,3H2,1-2H3.
What are the key properties of 1-hydroxy-3,4-dimethylimidazolidin-2-one?
1-hydroxy-3,4-dimethylimidazolidin-2-one has a molecular weight of 130.15 g/mol, XLogP of 0.13, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-3,4-dimethylimidazolidin-2-one is sourced from PubChem (CID 154468014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).