About 12-hydroperoxy-12-propoxydodeca-4,8-dienal
12-hydroperoxy-12-propoxydodeca-4,8-dienal (PubChem CID 154468064) has the molecular formula C15H26O4
and a molecular weight of 270.37 g/mol. Its IUPAC name is 12-hydroperoxy-12-propoxydodeca-4,8-dienal.
Molecular Properties
| Compound Name | 12-hydroperoxy-12-propoxydodeca-4,8-dienal |
| PubChem CID | 154468064 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 12-hydroperoxy-12-propoxydodeca-4,8-dienal |
| SMILES | CCCOC(CCC=CCCC=CCCC=O)OO |
| InChI | InChI=1S/C15H26O4/c1-2-14-18-15(19-17)12-10-8-6-4-3-5-7-9-11-13-16/h5-8,13,15,17H,2-4,9-12,14H2,1H3 |
| InChIKey | FCWYJCMSJJQUFO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 12-hydroperoxy-12-propoxydodeca-4,8-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-hydroperoxy-12-propoxydodeca-4,8-dienal?
The IUPAC name of 12-hydroperoxy-12-propoxydodeca-4,8-dienal (CID 154468064) is 12-hydroperoxy-12-propoxydodeca-4,8-dienal.
What is the SMILES notation for 12-hydroperoxy-12-propoxydodeca-4,8-dienal?
The canonical SMILES for 12-hydroperoxy-12-propoxydodeca-4,8-dienal is CCCOC(CCC=CCCC=CCCC=O)OO.
What is the InChIKey of 12-hydroperoxy-12-propoxydodeca-4,8-dienal?
The InChIKey is FCWYJCMSJJQUFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O4/c1-2-14-18-15(19-17)12-10-8-6-4-3-5-7-9-11-13-16/h5-8,13,15,17H,2-4,9-12,14H2,1H3.
What are the key properties of 12-hydroperoxy-12-propoxydodeca-4,8-dienal?
12-hydroperoxy-12-propoxydodeca-4,8-dienal has a molecular weight of 270.37 g/mol, XLogP of 3.88, 13 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 12-hydroperoxy-12-propoxydodeca-4,8-dienal is sourced from PubChem (CID 154468064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).