C16H17F3N6O2S — CID 154468786
2-[4-[4,6-dihydroxy-4-(trifluoromethyl)-2,5,6,7-tetrahydropyrazolo[3,4-b]pyridin-3-yl]piperidin-1-yl]-1,3-thiazole-5-carbonitrile (PubChem CID 154468786) has the molecular formula C16H17F3N6O2S and a molecular weight of 414.41 g/mol. Its IUPAC name is 2-[4-[4,6-dihydroxy-4-(trifluoromethyl)-2,5,6,7-tetrahydropyrazolo[3,4-b]pyridin-3-yl]piperidin-1-yl]-1,3-thiazole-5-carbonitrile.
| Compound Name | 2-[4-[4,6-dihydroxy-4-(trifluoromethyl)-2,5,6,7-tetrahydropyrazolo[3,4-b]pyridin-3-yl]piperidin-1-yl]-1,3-thiazole-5-carbonitrile |
|---|---|
| PubChem CID | 154468786 |
| Molecular Formula | C16H17F3N6O2S |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 2-[4-[4,6-dihydroxy-4-(trifluoromethyl)-2,5,6,7-tetrahydropyrazolo[3,4-b]pyridin-3-yl]piperidin-1-yl]-1,3-thiazole-5-carbonitrile |
| SMILES | N#Cc1cnc(N2CCC(c3[nH]nc4c3C(O)(C(F)(F)F)CC(O)N4)CC2)s1 |
| InChI | InChI=1S/C16H17F3N6O2S/c17-16(18,19)15(27)5-10(26)22-13-11(15)12(23-24-13)8-1-3-25(4-2-8)14-21-7-9(6-20)28-14/h7-8,10,26-27H,1-5H2,(H2,22,23,24) |
| InChIKey | OBBJULVPJOBQRX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 121.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |