C19H24N9O+ — CID 154469576
[5-(1-amino-3-methyliminoprop-1-en-2-yl)-3-[[(1S)-1-[3-(methoxymethyl)imidazo[1,2-a]pyridin-6-yl]ethyl]amino]pyrazin-2-yl]iminoazanium (PubChem CID 154469576) has the molecular formula C19H24N9O+ and a molecular weight of 394.46 g/mol. Its IUPAC name is [5-(1-amino-3-methyliminoprop-1-en-2-yl)-3-[[(1S)-1-[3-(methoxymethyl)imidazo[1,2-a]pyridin-6-yl]ethyl]amino]pyrazin-2-yl]iminoazanium.
| Compound Name | [5-(1-amino-3-methyliminoprop-1-en-2-yl)-3-[[(1S)-1-[3-(methoxymethyl)imidazo[1,2-a]pyridin-6-yl]ethyl]amino]pyrazin-2-yl]iminoazanium |
|---|---|
| PubChem CID | 154469576 |
| Molecular Formula | C19H24N9O+ |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | [5-(1-amino-3-methyliminoprop-1-en-2-yl)-3-[[(1S)-1-[3-(methoxymethyl)imidazo[1,2-a]pyridin-6-yl]ethyl]amino]pyrazin-2-yl]iminoazanium |
| SMILES | C/N=C/C(=CN)c1cnc(N=[NH2+])c(N[C@@H](C)c2ccc3ncc(COC)n3c2)n1 |
| InChI | InChI=1S/C19H23N9O/c1-12(13-4-5-17-23-8-15(11-29-3)28(17)10-13)25-19-18(27-21)24-9-16(26-19)14(6-20)7-22-2/h4-10,12,21H,11,20H2,1-3H3,(H,25,26)/p+1/b14-6?,22-7+,27-21?/t12-/m0/s1 |
| InChIKey | YNVHGKWZHIJRAN-JBDZJQLXSA-O |
| XLogP | 1.29 |
| TPSA | 140.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|