C24H24N2O2 — CID 154472131
6-(5-cyclobutyl-2-phenyl-4,5,6,7-tetrahydroindol-1-yl)pyridine-2-carboxylic acid (PubChem CID 154472131) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 6-(5-cyclobutyl-2-phenyl-4,5,6,7-tetrahydroindol-1-yl)pyridine-2-carboxylic acid.
| Compound Name | 6-(5-cyclobutyl-2-phenyl-4,5,6,7-tetrahydroindol-1-yl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 154472131 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 6-(5-cyclobutyl-2-phenyl-4,5,6,7-tetrahydroindol-1-yl)pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cccc(-n2c(-c3ccccc3)cc3c2CCC(C2CCC2)C3)n1 |
| InChI | InChI=1S/C24H24N2O2/c27-24(28)20-10-5-11-23(25-20)26-21-13-12-18(16-8-4-9-16)14-19(21)15-22(26)17-6-2-1-3-7-17/h1-3,5-7,10-11,15-16,18H,4,8-9,12-14H2,(H,27,28) |
| InChIKey | UXEVWAYXEAWKBX-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|