C32H56N4O3 — CID 154472824
N-[1-[[(E,3S)-6-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2,5-dimethyl-6-oxohex-4-en-3-yl]-methylamino]-3-methyl-1-oxobutan-2-yl]-1-propan-2-ylpiperidine-2-carboxamide (PubChem CID 154472824) has the molecular formula C32H56N4O3 and a molecular weight of 544.83 g/mol. Its IUPAC name is N-[1-[[(E,3S)-6-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2,5-dimethyl-6-oxohex-4-en-3-yl]-methylamino]-3-methyl-1-oxobutan-2-yl]-1-propan-2-ylpiperidine-2-carboxamide.
| Compound Name | N-[1-[[(E,3S)-6-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2,5-dimethyl-6-oxohex-4-en-3-yl]-methylamino]-3-methyl-1-oxobutan-2-yl]-1-propan-2-ylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 154472824 |
| Molecular Formula | C32H56N4O3 |
| Molecular Weight | 544.83 g/mol |
| Exact Mass | 544.44 |
| IUPAC Name | N-[1-[[(E,3S)-6-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2,5-dimethyl-6-oxohex-4-en-3-yl]-methylamino]-3-methyl-1-oxobutan-2-yl]-1-propan-2-ylpiperidine-2-carboxamide |
| SMILES | C/C(=C\[C@H](C(C)C)N(C)C(=O)C(NC(=O)C1CCCCN1C(C)C)C(C)C)C(=O)N1CCC2CCCCC2C1 |
| InChI | InChI=1S/C32H56N4O3/c1-21(2)28(19-24(7)31(38)35-18-16-25-13-9-10-14-26(25)20-35)34(8)32(39)29(22(3)4)33-30(37)27-15-11-12-17-36(27)23(5)6/h19,21-23,25-29H,9-18,20H2,1-8H3,(H,33,37)/b24-19+/t25?,26?,27?,28-,29?/m1/s1 |
| InChIKey | NMTGDEQXBUBTGV-YRDASDAESA-N |
| XLogP | 4.86 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.83 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|