About 2,6,7-trimethyl-2,3-dihydroimidazo[1,2-b]pyridazine
2,6,7-trimethyl-2,3-dihydroimidazo[1,2-b]pyridazine (PubChem CID 154473043) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is 2,6,7-trimethyl-2,3-dihydroimidazo[1,2-b]pyridazine.
Analyze 2,6,7-trimethyl-2,3-dihydroimidazo[1,2-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6,7-trimethyl-2,3-dihydroimidazo[1,2-b]pyridazine?
The IUPAC name of 2,6,7-trimethyl-2,3-dihydroimidazo[1,2-b]pyridazine (CID 154473043) is 2,6,7-trimethyl-2,3-dihydroimidazo[1,2-b]pyridazine.
What is the SMILES notation for 2,6,7-trimethyl-2,3-dihydroimidazo[1,2-b]pyridazine?
The canonical SMILES for 2,6,7-trimethyl-2,3-dihydroimidazo[1,2-b]pyridazine is CC1=CC2=NC(C)CN2N=C1C.
What is the InChIKey of 2,6,7-trimethyl-2,3-dihydroimidazo[1,2-b]pyridazine?
The InChIKey is MKDFVEBYEWCFTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3/c1-6-4-9-10-7(2)5-12(9)11-8(6)3/h4,7H,5H2,1-3H3.
What are the key properties of 2,6,7-trimethyl-2,3-dihydroimidazo[1,2-b]pyridazine?
2,6,7-trimethyl-2,3-dihydroimidazo[1,2-b]pyridazine has a molecular weight of 163.22 g/mol, XLogP of 1.42, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6,7-trimethyl-2,3-dihydroimidazo[1,2-b]pyridazine is sourced from PubChem (CID 154473043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).