C20H21F2NO3 — CID 154473397
(1S,15R)-6,6-difluoro-3-methyl-15-prop-2-enyl-2,19-dioxa-8-azapentacyclo[11.5.1.01,15.04,12.05,9]nonadeca-4(12),5(9),10-trien-7-one (PubChem CID 154473397) has the molecular formula C20H21F2NO3 and a molecular weight of 361.39 g/mol. Its IUPAC name is (1S,15R)-6,6-difluoro-3-methyl-15-prop-2-enyl-2,19-dioxa-8-azapentacyclo[11.5.1.01,15.04,12.05,9]nonadeca-4(12),5(9),10-trien-7-one.
| Compound Name | (1S,15R)-6,6-difluoro-3-methyl-15-prop-2-enyl-2,19-dioxa-8-azapentacyclo[11.5.1.01,15.04,12.05,9]nonadeca-4(12),5(9),10-trien-7-one |
|---|---|
| PubChem CID | 154473397 |
| Molecular Formula | C20H21F2NO3 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | (1S,15R)-6,6-difluoro-3-methyl-15-prop-2-enyl-2,19-dioxa-8-azapentacyclo[11.5.1.01,15.04,12.05,9]nonadeca-4(12),5(9),10-trien-7-one |
| SMILES | C=CC[C@@]12CCC[C@@]13OC(C)c1c(ccc4c1C(F)(F)C(=O)N4)C(C2)O3 |
| InChI | InChI=1S/C20H21F2NO3/c1-3-7-18-8-4-9-19(18)25-11(2)15-12(14(10-18)26-19)5-6-13-16(15)20(21,22)17(24)23-13/h3,5-6,11,14H,1,4,7-10H2,2H3,(H,23,24)/t11?,14?,18-,19-/m0/s1 |
| InChIKey | CRLHGHJEEFJCEZ-OCPFIKATSA-N |
| XLogP | 4.73 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|