About bicyclo[4.1.0]hept-2-yne
bicyclo[4.1.0]hept-2-yne (PubChem CID 154474134) has the molecular formula C7H8
and a molecular weight of 92.14 g/mol. Its IUPAC name is bicyclo[4.1.0]hept-2-yne.
Molecular Properties
| Compound Name | bicyclo[4.1.0]hept-2-yne |
| PubChem CID | 154474134 |
| Molecular Formula | C7H8 |
| Molecular Weight | 92.14 g/mol |
| Exact Mass | 92.06 |
| IUPAC Name | bicyclo[4.1.0]hept-2-yne |
| SMILES | C1#CC2CC2CC1 |
| InChI | InChI=1S/C7H8/c1-2-4-7-5-6(7)3-1/h6-7H,1,3,5H2 |
| InChIKey | LMDNOZSEDDQUEF-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 92.14 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[4.1.0]hept-2-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[4.1.0]hept-2-yne?
The IUPAC name of bicyclo[4.1.0]hept-2-yne (CID 154474134) is bicyclo[4.1.0]hept-2-yne.
What is the SMILES notation for bicyclo[4.1.0]hept-2-yne?
The canonical SMILES for bicyclo[4.1.0]hept-2-yne is C1#CC2CC2CC1.
What is the InChIKey of bicyclo[4.1.0]hept-2-yne?
The InChIKey is LMDNOZSEDDQUEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8/c1-2-4-7-5-6(7)3-1/h6-7H,1,3,5H2.
What are the key properties of bicyclo[4.1.0]hept-2-yne?
bicyclo[4.1.0]hept-2-yne has a molecular weight of 92.14 g/mol, XLogP of 1.42, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[4.1.0]hept-2-yne is sourced from PubChem (CID 154474134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).