C26H18F9NO2S — CID 154475972
(1R,5S,8aS)-1-[3,5-bis(trifluoromethyl)phenyl]-5-[2-thiophen-3-yl-5-(trifluoromethyl)phenyl]-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one (PubChem CID 154475972) has the molecular formula C26H18F9NO2S and a molecular weight of 579.48 g/mol. Its IUPAC name is (1R,5S,8aS)-1-[3,5-bis(trifluoromethyl)phenyl]-5-[2-thiophen-3-yl-5-(trifluoromethyl)phenyl]-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one.
| Compound Name | (1R,5S,8aS)-1-[3,5-bis(trifluoromethyl)phenyl]-5-[2-thiophen-3-yl-5-(trifluoromethyl)phenyl]-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
|---|---|
| PubChem CID | 154475972 |
| Molecular Formula | C26H18F9NO2S |
| Molecular Weight | 579.48 g/mol |
| Exact Mass | 579.09 |
| IUPAC Name | (1R,5S,8aS)-1-[3,5-bis(trifluoromethyl)phenyl]-5-[2-thiophen-3-yl-5-(trifluoromethyl)phenyl]-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
| SMILES | O=C1O[C@H](c2cc(C(F)(F)F)cc(C(F)(F)F)c2)[C@@H]2CCC[C@@H](c3cc(C(F)(F)F)ccc3-c3ccsc3)N12 |
| InChI | InChI=1S/C26H18F9NO2S/c27-24(28,29)15-4-5-18(13-6-7-39-12-13)19(11-15)20-2-1-3-21-22(38-23(37)36(20)21)14-8-16(25(30,31)32)10-17(9-14)26(33,34)35/h4-12,20-22H,1-3H2/t20-,21-,22+/m0/s1 |
| InChIKey | NDDKCFRXSDBBNZ-FDFHNCONSA-N |
| XLogP | 9.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.48 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |