C11H19N3O2S — CID 154477106
1-piperidin-2-ylsulfonylcyclohexa-3,5-diene-1,2-diamine (PubChem CID 154477106) has the molecular formula C11H19N3O2S and a molecular weight of 257.36 g/mol. Its IUPAC name is 1-piperidin-2-ylsulfonylcyclohexa-3,5-diene-1,2-diamine.
| Compound Name | 1-piperidin-2-ylsulfonylcyclohexa-3,5-diene-1,2-diamine |
|---|---|
| PubChem CID | 154477106 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 1-piperidin-2-ylsulfonylcyclohexa-3,5-diene-1,2-diamine |
| SMILES | NC1C=CC=CC1(N)S(=O)(=O)C1CCCCN1 |
| InChI | InChI=1S/C11H19N3O2S/c12-9-5-1-3-7-11(9,13)17(15,16)10-6-2-4-8-14-10/h1,3,5,7,9-10,14H,2,4,6,8,12-13H2 |
| InChIKey | IRHKOBFRJKPYDC-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |