C13H20N4O3S — CID 154477289
1-(2,2-dimethoxyethyl)-1-methyl-3-[5-(2-methylbut-3-yn-2-yl)-1,3,4-thiadiazol-2-yl]urea (PubChem CID 154477289) has the molecular formula C13H20N4O3S and a molecular weight of 312.40 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-1-methyl-3-[5-(2-methylbut-3-yn-2-yl)-1,3,4-thiadiazol-2-yl]urea.
| Compound Name | 1-(2,2-dimethoxyethyl)-1-methyl-3-[5-(2-methylbut-3-yn-2-yl)-1,3,4-thiadiazol-2-yl]urea |
|---|---|
| PubChem CID | 154477289 |
| Molecular Formula | C13H20N4O3S |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-1-methyl-3-[5-(2-methylbut-3-yn-2-yl)-1,3,4-thiadiazol-2-yl]urea |
| SMILES | C#CC(C)(C)c1nnc(NC(=O)N(C)CC(OC)OC)s1 |
| InChI | InChI=1S/C13H20N4O3S/c1-7-13(2,3)10-15-16-11(21-10)14-12(18)17(4)8-9(19-5)20-6/h1,9H,8H2,2-6H3,(H,14,16,18) |
| InChIKey | DQWVHSTVPPGYGE-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|