C12H17F3N4O2S — CID 154477566
methyl 5-[3-(2,2,2-trifluoroethylcarbamothioylamino)pyrazol-1-yl]pentanoate (PubChem CID 154477566) has the molecular formula C12H17F3N4O2S and a molecular weight of 338.36 g/mol. Its IUPAC name is methyl 5-[3-(2,2,2-trifluoroethylcarbamothioylamino)pyrazol-1-yl]pentanoate.
| Compound Name | methyl 5-[3-(2,2,2-trifluoroethylcarbamothioylamino)pyrazol-1-yl]pentanoate |
|---|---|
| PubChem CID | 154477566 |
| Molecular Formula | C12H17F3N4O2S |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | methyl 5-[3-(2,2,2-trifluoroethylcarbamothioylamino)pyrazol-1-yl]pentanoate |
| SMILES | COC(=O)CCCCn1ccc(NC(=S)NCC(F)(F)F)n1 |
| InChI | InChI=1S/C12H17F3N4O2S/c1-21-10(20)4-2-3-6-19-7-5-9(18-19)17-11(22)16-8-12(13,14)15/h5,7H,2-4,6,8H2,1H3,(H2,16,17,18,22) |
| InChIKey | DTHLUWCTCULGMH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|