C12H14F3N4O2S- — CID 154477662
3-[2-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]cyclopentane-1-carboxylate (PubChem CID 154477662) has the molecular formula C12H14F3N4O2S- and a molecular weight of 335.33 g/mol. Its IUPAC name is 3-[2-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]cyclopentane-1-carboxylate.
| Compound Name | 3-[2-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 154477662 |
| Molecular Formula | C12H14F3N4O2S- |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 3-[2-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]cyclopentane-1-carboxylate |
| SMILES | N/C(=N\CC(F)(F)F)Nc1nc(C2CCC(C(=O)[O-])C2)cs1 |
| InChI | InChI=1S/C12H15F3N4O2S/c13-12(14,15)5-17-10(16)19-11-18-8(4-22-11)6-1-2-7(3-6)9(20)21/h4,6-7H,1-3,5H2,(H,20,21)(H3,16,17,18,19)/p-1 |
| InChIKey | GNRAMWFYCNHDSF-UHFFFAOYSA-M |
| XLogP | 1.07 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|