About N-ethyl-6,7a-dihydro-5H-thieno[2,3-b]thiopyran-4-amine
N-ethyl-6,7a-dihydro-5H-thieno[2,3-b]thiopyran-4-amine (PubChem CID 154479061) has the molecular formula C9H13NS2
and a molecular weight of 199.34 g/mol. Its IUPAC name is N-ethyl-6,7a-dihydro-5H-thieno[2,3-b]thiopyran-4-amine.
Molecular Properties
| Compound Name | N-ethyl-6,7a-dihydro-5H-thieno[2,3-b]thiopyran-4-amine |
| PubChem CID | 154479061 |
| Molecular Formula | C9H13NS2 |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | N-ethyl-6,7a-dihydro-5H-thieno[2,3-b]thiopyran-4-amine |
| SMILES | CCNC1=C2C=CSC2SCC1 |
| InChI | InChI=1S/C9H13NS2/c1-2-10-8-4-6-12-9-7(8)3-5-11-9/h3,5,9-10H,2,4,6H2,1H3 |
| InChIKey | BOYXWWYVGFOTQW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-6,7a-dihydro-5H-thieno[2,3-b]thiopyran-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-6,7a-dihydro-5H-thieno[2,3-b]thiopyran-4-amine?
The IUPAC name of N-ethyl-6,7a-dihydro-5H-thieno[2,3-b]thiopyran-4-amine (CID 154479061) is N-ethyl-6,7a-dihydro-5H-thieno[2,3-b]thiopyran-4-amine.
What is the SMILES notation for N-ethyl-6,7a-dihydro-5H-thieno[2,3-b]thiopyran-4-amine?
The canonical SMILES for N-ethyl-6,7a-dihydro-5H-thieno[2,3-b]thiopyran-4-amine is CCNC1=C2C=CSC2SCC1.
What is the InChIKey of N-ethyl-6,7a-dihydro-5H-thieno[2,3-b]thiopyran-4-amine?
The InChIKey is BOYXWWYVGFOTQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NS2/c1-2-10-8-4-6-12-9-7(8)3-5-11-9/h3,5,9-10H,2,4,6H2,1H3.
What are the key properties of N-ethyl-6,7a-dihydro-5H-thieno[2,3-b]thiopyran-4-amine?
N-ethyl-6,7a-dihydro-5H-thieno[2,3-b]thiopyran-4-amine has a molecular weight of 199.34 g/mol, XLogP of 2.57, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-6,7a-dihydro-5H-thieno[2,3-b]thiopyran-4-amine is sourced from PubChem (CID 154479061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).