C15H12Cl3F2N3O3 — CID 154479233
5-[[4-(2-chloro-1,2-difluoroethenoxy)-2-(2,4-dichlorophenyl)-4-methyl-1,3-dioxolan-2-yl]methyl]-1H-1,2,4-triazole (PubChem CID 154479233) has the molecular formula C15H12Cl3F2N3O3 and a molecular weight of 426.63 g/mol. Its IUPAC name is 5-[[4-(2-chloro-1,2-difluoroethenoxy)-2-(2,4-dichlorophenyl)-4-methyl-1,3-dioxolan-2-yl]methyl]-1H-1,2,4-triazole.
| Compound Name | 5-[[4-(2-chloro-1,2-difluoroethenoxy)-2-(2,4-dichlorophenyl)-4-methyl-1,3-dioxolan-2-yl]methyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 154479233 |
| Molecular Formula | C15H12Cl3F2N3O3 |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 424.99 |
| IUPAC Name | 5-[[4-(2-chloro-1,2-difluoroethenoxy)-2-(2,4-dichlorophenyl)-4-methyl-1,3-dioxolan-2-yl]methyl]-1H-1,2,4-triazole |
| SMILES | CC1(OC(F)=C(F)Cl)COC(Cc2ncn[nH]2)(c2ccc(Cl)cc2Cl)O1 |
| InChI | InChI=1S/C15H12Cl3F2N3O3/c1-14(25-13(20)12(18)19)6-24-15(26-14,5-11-21-7-22-23-11)9-3-2-8(16)4-10(9)17/h2-4,7H,5-6H2,1H3,(H,21,22,23) |
| InChIKey | DSQFRYWXKSYRFI-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|