C34H42F2N4O9 — CID 154479419
(2S)-6-amino-2-[[2,2-difluoro-5-methyl-3-oxo-4-[(1-phenylmethoxycarbonylpyrrolidine-2-carbonyl)amino]hexanoyl]-phenylmethoxycarbonylamino]hexanoic acid (PubChem CID 154479419) has the molecular formula C34H42F2N4O9 and a molecular weight of 688.73 g/mol. Its IUPAC name is (2S)-6-amino-2-[[2,2-difluoro-5-methyl-3-oxo-4-[(1-phenylmethoxycarbonylpyrrolidine-2-carbonyl)amino]hexanoyl]-phenylmethoxycarbonylamino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[2,2-difluoro-5-methyl-3-oxo-4-[(1-phenylmethoxycarbonylpyrrolidine-2-carbonyl)amino]hexanoyl]-phenylmethoxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 154479419 |
| Molecular Formula | C34H42F2N4O9 |
| Molecular Weight | 688.73 g/mol |
| Exact Mass | 688.29 |
| IUPAC Name | (2S)-6-amino-2-[[2,2-difluoro-5-methyl-3-oxo-4-[(1-phenylmethoxycarbonylpyrrolidine-2-carbonyl)amino]hexanoyl]-phenylmethoxycarbonylamino]hexanoic acid |
| SMILES | CC(C)C(NC(=O)C1CCCN1C(=O)OCc1ccccc1)C(=O)C(F)(F)C(=O)N(C(=O)OCc1ccccc1)[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C34H42F2N4O9/c1-22(2)27(38-29(42)25-17-11-19-39(25)32(46)48-20-23-12-5-3-6-13-23)28(41)34(35,36)31(45)40(26(30(43)44)16-9-10-18-37)33(47)49-21-24-14-7-4-8-15-24/h3-8,12-15,22,25-27H,9-11,16-21,37H2,1-2H3,(H,38,42)(H,43,44)/t25?,26-,27?/m0/s1 |
| InChIKey | TXRXUFKAJSNJMA-QLLQDVQFSA-N |
| XLogP | 3.88 |
| TPSA | 185.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.73 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|