C23H33FS — CID 154479476
(7S,8S,9S,10R,13R,14S,16S)-4-ethylsulfanyl-16-fluoro-7,10,13-trimethyl-6-methylidene-3,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 154479476) has the molecular formula C23H33FS and a molecular weight of 360.58 g/mol. Its IUPAC name is (7S,8S,9S,10R,13R,14S,16S)-4-ethylsulfanyl-16-fluoro-7,10,13-trimethyl-6-methylidene-3,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | (7S,8S,9S,10R,13R,14S,16S)-4-ethylsulfanyl-16-fluoro-7,10,13-trimethyl-6-methylidene-3,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 154479476 |
| Molecular Formula | C23H33FS |
| Molecular Weight | 360.58 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (7S,8S,9S,10R,13R,14S,16S)-4-ethylsulfanyl-16-fluoro-7,10,13-trimethyl-6-methylidene-3,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | C=C1C2=C(SCC)CC=C[C@]2(C)[C@H]2CC[C@]3(C)C[C@@H](F)C[C@H]3[C@@H]2[C@@H]1C |
| InChI | InChI=1S/C23H33FS/c1-6-25-19-8-7-10-23(5)17-9-11-22(4)13-16(24)12-18(22)20(17)14(2)15(3)21(19)23/h7,10,14,16-18,20H,3,6,8-9,11-13H2,1-2,4-5H3/t14-,16+,17+,18+,20-,22-,23-/m1/s1 |
| InChIKey | ZWXSYWLOGLFCBM-MDCXMCGGSA-N |
| XLogP | 6.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.58 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|