About 5-(2,2-dichloroacetyl)-1,3-oxazol-4-one
5-(2,2-dichloroacetyl)-1,3-oxazol-4-one (PubChem CID 154479607) has the molecular formula C5H3Cl2NO3
and a molecular weight of 195.99 g/mol. Its IUPAC name is 5-(2,2-dichloroacetyl)-1,3-oxazol-4-one.
Molecular Properties
| Compound Name | 5-(2,2-dichloroacetyl)-1,3-oxazol-4-one |
| PubChem CID | 154479607 |
| Molecular Formula | C5H3Cl2NO3 |
| Molecular Weight | 195.99 g/mol |
| Exact Mass | 194.95 |
| IUPAC Name | 5-(2,2-dichloroacetyl)-1,3-oxazol-4-one |
| SMILES | O=C1N=COC1C(=O)C(Cl)Cl |
| InChI | InChI=1S/C5H3Cl2NO3/c6-4(7)2(9)3-5(10)8-1-11-3/h1,3-4H |
| InChIKey | XUIDAYVTBKEMKV-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.99 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,2-dichloroacetyl)-1,3-oxazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-dichloroacetyl)-1,3-oxazol-4-one?
The IUPAC name of 5-(2,2-dichloroacetyl)-1,3-oxazol-4-one (CID 154479607) is 5-(2,2-dichloroacetyl)-1,3-oxazol-4-one.
What is the SMILES notation for 5-(2,2-dichloroacetyl)-1,3-oxazol-4-one?
The canonical SMILES for 5-(2,2-dichloroacetyl)-1,3-oxazol-4-one is O=C1N=COC1C(=O)C(Cl)Cl.
What is the InChIKey of 5-(2,2-dichloroacetyl)-1,3-oxazol-4-one?
The InChIKey is XUIDAYVTBKEMKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3Cl2NO3/c6-4(7)2(9)3-5(10)8-1-11-3/h1,3-4H.
What are the key properties of 5-(2,2-dichloroacetyl)-1,3-oxazol-4-one?
5-(2,2-dichloroacetyl)-1,3-oxazol-4-one has a molecular weight of 195.99 g/mol, XLogP of 0.31, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-dichloroacetyl)-1,3-oxazol-4-one is sourced from PubChem (CID 154479607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).