C23H22N2O — CID 154479963
13-(4-methylphenyl)-14-oxido-11-aza-14-azoniatetracyclo[9.6.1.05,18.012,17]octadeca-1,3,5(18),12(17),13,15-hexaene (PubChem CID 154479963) has the molecular formula C23H22N2O and a molecular weight of 342.44 g/mol. Its IUPAC name is 13-(4-methylphenyl)-14-oxido-11-aza-14-azoniatetracyclo[9.6.1.05,18.012,17]octadeca-1,3,5(18),12(17),13,15-hexaene.
| Compound Name | 13-(4-methylphenyl)-14-oxido-11-aza-14-azoniatetracyclo[9.6.1.05,18.012,17]octadeca-1,3,5(18),12(17),13,15-hexaene |
|---|---|
| PubChem CID | 154479963 |
| Molecular Formula | C23H22N2O |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 13-(4-methylphenyl)-14-oxido-11-aza-14-azoniatetracyclo[9.6.1.05,18.012,17]octadeca-1,3,5(18),12(17),13,15-hexaene |
| SMILES | Cc1ccc(-c2c3c(cc[n+]2[O-])c2cccc4c2n3CCCCC4)cc1 |
| InChI | InChI=1S/C23H22N2O/c1-16-9-11-18(12-10-16)22-23-20(13-15-25(22)26)19-8-5-7-17-6-3-2-4-14-24(23)21(17)19/h5,7-13,15H,2-4,6,14H2,1H3 |
| InChIKey | LTSFKDLJGKQETP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 31.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|