C10H7Br3O — CID 15448002
(1S,2R,3R)-1,2,3-tribromo-2,3-dihydroindene-1-carbaldehyde (PubChem CID 15448002) has the molecular formula C10H7Br3O and a molecular weight of 382.88 g/mol. Its IUPAC name is (1S,2R,3R)-1,2,3-tribromo-2,3-dihydroindene-1-carbaldehyde.
| Compound Name | (1S,2R,3R)-1,2,3-tribromo-2,3-dihydroindene-1-carbaldehyde |
|---|---|
| PubChem CID | 15448002 |
| Molecular Formula | C10H7Br3O |
| Molecular Weight | 382.88 g/mol |
| Exact Mass | 379.80 |
| IUPAC Name | (1S,2R,3R)-1,2,3-tribromo-2,3-dihydroindene-1-carbaldehyde |
| SMILES | O=C[C@@]1(Br)c2ccccc2[C@@H](Br)[C@H]1Br |
| InChI | InChI=1S/C10H7Br3O/c11-8-6-3-1-2-4-7(6)10(13,5-14)9(8)12/h1-5,8-9H/t8-,9-,10-/m1/s1 |
| InChIKey | JNVDSNXUVUTPCX-OPRDCNLKSA-N |
| XLogP | 3.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.88 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|