C20H21F3N2O2 — CID 154480486
N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-2,4,6-trifluorobenzohydrazide (PubChem CID 154480486) has the molecular formula C20H21F3N2O2 and a molecular weight of 378.39 g/mol. Its IUPAC name is N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-2,4,6-trifluorobenzohydrazide.
| Compound Name | N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-2,4,6-trifluorobenzohydrazide |
|---|---|
| PubChem CID | 154480486 |
| Molecular Formula | C20H21F3N2O2 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-2,4,6-trifluorobenzohydrazide |
| SMILES | Cc1cc(C)cc(C(=O)N(NC(=O)c2c(F)cc(F)cc2F)C(C)(C)C)c1 |
| InChI | InChI=1S/C20H21F3N2O2/c1-11-6-12(2)8-13(7-11)19(27)25(20(3,4)5)24-18(26)17-15(22)9-14(21)10-16(17)23/h6-10H,1-5H3,(H,24,26) |
| InChIKey | KFQLIYJWUXZZFL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|