C21H25N3O — CID 154480744
2-[(6aR,9R)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]-N-cyclopropyl-N-methylacetamide (PubChem CID 154480744) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is 2-[(6aR,9R)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]-N-cyclopropyl-N-methylacetamide.
| Compound Name | 2-[(6aR,9R)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]-N-cyclopropyl-N-methylacetamide |
|---|---|
| PubChem CID | 154480744 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 2-[(6aR,9R)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]-N-cyclopropyl-N-methylacetamide |
| SMILES | CN(C(=O)C[C@@H]1C=C2c3cccc4[nH]cc(c34)C[C@H]2N(C)C1)C1CC1 |
| InChI | InChI=1S/C21H25N3O/c1-23-12-13(9-20(25)24(2)15-6-7-15)8-17-16-4-3-5-18-21(16)14(11-22-18)10-19(17)23/h3-5,8,11,13,15,19,22H,6-7,9-10,12H2,1-2H3/t13-,19+/m0/s1 |
| InChIKey | BALQTAIXHXLZCT-ORAYPTAESA-N |
| XLogP | 3.05 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |