C26H41N — CID 154480859
4-[(8R,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N,N-dimethylpenta-1,3-dien-1-amine (PubChem CID 154480859) has the molecular formula C26H41N and a molecular weight of 367.62 g/mol. Its IUPAC name is 4-[(8R,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N,N-dimethylpenta-1,3-dien-1-amine.
| Compound Name | 4-[(8R,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N,N-dimethylpenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 154480859 |
| Molecular Formula | C26H41N |
| Molecular Weight | 367.62 g/mol |
| Exact Mass | 367.32 |
| IUPAC Name | 4-[(8R,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N,N-dimethylpenta-1,3-dien-1-amine |
| SMILES | CC(=CC=CN(C)C)C1=CC[C@H]2[C@@H]3CCC4CCCC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H41N/c1-19(9-8-18-27(4)5)22-13-14-23-21-12-11-20-10-6-7-16-25(20,2)24(21)15-17-26(22,23)3/h8-9,13,18,20-21,23-24H,6-7,10-12,14-17H2,1-5H3/t20?,21-,23-,24-,25-,26+/m0/s1 |
| InChIKey | SKADABWKKBBJQS-COBDPRAWSA-N |
| XLogP | 6.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.62 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|