C34H36N2O2 — CID 15448089
2,9-bis(5-tert-butyl-2-methoxyphenyl)-1,10-phenanthroline (PubChem CID 15448089) has the molecular formula C34H36N2O2 and a molecular weight of 504.67 g/mol. Its IUPAC name is 2,9-bis(5-tert-butyl-2-methoxyphenyl)-1,10-phenanthroline.
| Compound Name | 2,9-bis(5-tert-butyl-2-methoxyphenyl)-1,10-phenanthroline |
|---|---|
| PubChem CID | 15448089 |
| Molecular Formula | C34H36N2O2 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.28 |
| IUPAC Name | 2,9-bis(5-tert-butyl-2-methoxyphenyl)-1,10-phenanthroline |
| SMILES | COc1ccc(C(C)(C)C)cc1-c1ccc2ccc3ccc(-c4cc(C(C)(C)C)ccc4OC)nc3c2n1 |
| InChI | InChI=1S/C34H36N2O2/c1-33(2,3)23-13-17-29(37-7)25(19-23)27-15-11-21-9-10-22-12-16-28(36-32(22)31(21)35-27)26-20-24(34(4,5)6)14-18-30(26)38-8/h9-20H,1-8H3 |
| InChIKey | MWUSGPPNHHLIHG-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|