About 2,9-bis(5-tert-butyl-2-methoxy-3-pyridin-2-ylphenyl)-1,10-phenanthroline
2,9-bis(5-tert-butyl-2-methoxy-3-pyridin-2-ylphenyl)-1,10-phenanthroline (PubChem CID 15448097) has the molecular formula C44H42N4O2
and a molecular weight of 658.85 g/mol. Its IUPAC name is 2,9-bis(5-tert-butyl-2-methoxy-3-pyridin-2-ylphenyl)-1,10-phenanthroline.
Molecular Properties
| Compound Name | 2,9-bis(5-tert-butyl-2-methoxy-3-pyridin-2-ylphenyl)-1,10-phenanthroline |
| PubChem CID | 15448097 |
| Molecular Formula | C44H42N4O2 |
| Molecular Weight | 658.85 g/mol |
| Exact Mass | 658.33 |
| IUPAC Name | 2,9-bis(5-tert-butyl-2-methoxy-3-pyridin-2-ylphenyl)-1,10-phenanthroline |
| SMILES | COc1c(-c2ccccn2)cc(C(C)(C)C)cc1-c1ccc2ccc3ccc(-c4cc(C(C)(C)C)cc(-c5ccccn5)c4OC)nc3c2n1 |
| InChI | InChI=1S/C44H42N4O2/c1-43(2,3)29-23-31(35-13-9-11-21-45-35)41(49-7)33(25-29)37-19-17-27-15-16-28-18-20-38(48-40(28)39(27)47-37)34-26-30(44(4,5)6)24-32(42(34)50-8)36-14-10-12-22-46-36/h9-26H,1-8H3 |
| InChIKey | ZDIKGKHYYDLEQR-UHFFFAOYSA-N |
| XLogP | 10.85 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 658.85 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2,9-bis(5-tert-butyl-2-methoxy-3-pyridin-2-ylphenyl)-1,10-phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,9-bis(5-tert-butyl-2-methoxy-3-pyridin-2-ylphenyl)-1,10-phenanthroline?
The IUPAC name of 2,9-bis(5-tert-butyl-2-methoxy-3-pyridin-2-ylphenyl)-1,10-phenanthroline (CID 15448097) is 2,9-bis(5-tert-butyl-2-methoxy-3-pyridin-2-ylphenyl)-1,10-phenanthroline.
What is the SMILES notation for 2,9-bis(5-tert-butyl-2-methoxy-3-pyridin-2-ylphenyl)-1,10-phenanthroline?
The canonical SMILES for 2,9-bis(5-tert-butyl-2-methoxy-3-pyridin-2-ylphenyl)-1,10-phenanthroline is COc1c(-c2ccccn2)cc(C(C)(C)C)cc1-c1ccc2ccc3ccc(-c4cc(C(C)(C)C)cc(-c5ccccn5)c4OC)nc3c2n1.
What is the InChIKey of 2,9-bis(5-tert-butyl-2-methoxy-3-pyridin-2-ylphenyl)-1,10-phenanthroline?
The InChIKey is ZDIKGKHYYDLEQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C44H42N4O2/c1-43(2,3)29-23-31(35-13-9-11-21-45-35)41(49-7)33(25-29)37-19-17-27-15-16-28-18-20-38(48-40(28)39(27)47-37)34-26-30(44(4,5)6)24-32(42(34)50-8)36-14-10-12-22-46-36/h9-26H,1-8H3.
What are the key properties of 2,9-bis(5-tert-butyl-2-methoxy-3-pyridin-2-ylphenyl)-1,10-phenanthroline?
2,9-bis(5-tert-butyl-2-methoxy-3-pyridin-2-ylphenyl)-1,10-phenanthroline has a molecular weight of 658.85 g/mol, XLogP of 10.85, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,9-bis(5-tert-butyl-2-methoxy-3-pyridin-2-ylphenyl)-1,10-phenanthroline is sourced from PubChem (CID 15448097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).