C96H188O28Si13 — CID 15448112
tetrakis[3-[methyl-bis[3-[methyl-bis(prop-2-enoxy)silyl]propoxy]silyl]propyl] silicate (PubChem CID 15448112) has the molecular formula C96H188O28Si13 and a molecular weight of 2155.65 g/mol. Its IUPAC name is tetrakis[3-[methyl-bis[3-[methyl-bis(prop-2-enoxy)silyl]propoxy]silyl]propyl] silicate.
| Compound Name | tetrakis[3-[methyl-bis[3-[methyl-bis(prop-2-enoxy)silyl]propoxy]silyl]propyl] silicate |
|---|---|
| PubChem CID | 15448112 |
| Molecular Formula | C96H188O28Si13 |
| Molecular Weight | 2155.65 g/mol |
| Exact Mass | 2153.03 |
| IUPAC Name | tetrakis[3-[methyl-bis[3-[methyl-bis(prop-2-enoxy)silyl]propoxy]silyl]propyl] silicate |
| SMILES | C=CCO[Si](C)(CCCO[Si](C)(CCCO[Si](OCCC[Si](C)(OCCC[Si](C)(OCC=C)OCC=C)OCCC[Si](C)(OCC=C)OCC=C)(OCCC[Si](C)(OCCC[Si](C)(OCC=C)OCC=C)OCCC[Si](C)(OCC=C)OCC=C)OCCC[Si](C)(OCCC[Si](C)(OCC=C)OCC=C)OCCC[Si](C)(OCC=C)OCC=C)OCCC[Si](C)(OCC=C)OCC=C)OCC=C |
| InChI | InChI=1S/C96H188O28Si13/c1-29-57-97-125(17,98-58-30-2)85-45-73-113-133(25,114-74-46-86-126(18,99-59-31-3)100-60-32-4)93-53-81-121-137(122-82-54-94-134(26,115-75-47-87-127(19,101-61-33-5)102-62-34-6)116-76-48-88-128(20,103-63-35-7)104-64-36-8,123-83-55-95-135(27,117-77-49-89-129(21,105-65-37-9)106-66-38-10)118-78-50-90-130(22,107-67-39-11)108-68-40-12)124-84-56-96-136(28,119-79-51-91-131(23,109-69-41-13)110-70-42-14)120-80-52-92-132(24,111-71-43-15)112-72-44-16/h29-44H,1-16,45-96H2,17-28H3 |
| InChIKey | PLTIWODQYVGKRL-UHFFFAOYSA-N |
| XLogP | 22.41 |
| TPSA | 258.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 28 |
| Rotatable Bonds | 108 |
| Heavy Atoms | 137 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 2155.65 |
| LogP ≤ 5 | 22.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 28 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|