About 3-imino-4H-pyrazolo[4,3-b]pyridin-5-one
3-imino-4H-pyrazolo[4,3-b]pyridin-5-one (PubChem CID 154482566) has the molecular formula C6H4N4O
and a molecular weight of 148.12 g/mol. Its IUPAC name is 3-imino-4H-pyrazolo[4,3-b]pyridin-5-one.
Molecular Properties
| Compound Name | 3-imino-4H-pyrazolo[4,3-b]pyridin-5-one |
| PubChem CID | 154482566 |
| Molecular Formula | C6H4N4O |
| Molecular Weight | 148.12 g/mol |
| Exact Mass | 148.04 |
| IUPAC Name | 3-imino-4H-pyrazolo[4,3-b]pyridin-5-one |
| SMILES | [H]/N=C1\N=Nc2ccc(=O)[nH]c21 |
| InChI | InChI=1S/C6H4N4O/c7-6-5-3(9-10-6)1-2-4(11)8-5/h1-2,7H,(H,8,11)/b7-6- |
| InChIKey | YVOZXMNANYRUDE-SREVYHEPSA-N |
| XLogP | 0.80 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.12 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-imino-4H-pyrazolo[4,3-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imino-4H-pyrazolo[4,3-b]pyridin-5-one?
The IUPAC name of 3-imino-4H-pyrazolo[4,3-b]pyridin-5-one (CID 154482566) is 3-imino-4H-pyrazolo[4,3-b]pyridin-5-one.
What is the SMILES notation for 3-imino-4H-pyrazolo[4,3-b]pyridin-5-one?
The canonical SMILES for 3-imino-4H-pyrazolo[4,3-b]pyridin-5-one is [H]/N=C1\N=Nc2ccc(=O)[nH]c21.
What is the InChIKey of 3-imino-4H-pyrazolo[4,3-b]pyridin-5-one?
The InChIKey is YVOZXMNANYRUDE-SREVYHEPSA-N. The full InChI is InChI=1S/C6H4N4O/c7-6-5-3(9-10-6)1-2-4(11)8-5/h1-2,7H,(H,8,11)/b7-6-.
What are the key properties of 3-imino-4H-pyrazolo[4,3-b]pyridin-5-one?
3-imino-4H-pyrazolo[4,3-b]pyridin-5-one has a molecular weight of 148.12 g/mol, XLogP of 0.80, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imino-4H-pyrazolo[4,3-b]pyridin-5-one is sourced from PubChem (CID 154482566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).