C12H16F2N6 — CID 154483109
(3Z)-5,5-difluoro-6-imino-6-(2-imino-5-methyl-1-pyridinyl)hexa-1,3-diene-1,1,4-triamine (PubChem CID 154483109) has the molecular formula C12H16F2N6 and a molecular weight of 282.30 g/mol. Its IUPAC name is (3Z)-5,5-difluoro-6-imino-6-(2-imino-5-methyl-1-pyridinyl)hexa-1,3-diene-1,1,4-triamine.
| Compound Name | (3Z)-5,5-difluoro-6-imino-6-(2-imino-5-methyl-1-pyridinyl)hexa-1,3-diene-1,1,4-triamine |
|---|---|
| PubChem CID | 154483109 |
| Molecular Formula | C12H16F2N6 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | (3Z)-5,5-difluoro-6-imino-6-(2-imino-5-methyl-1-pyridinyl)hexa-1,3-diene-1,1,4-triamine |
| SMILES | [H]/N=C(/n1cc(C)cc/c1=N\[H])C(F)(F)/C(N)=C/C=C(N)N |
| InChI | InChI=1S/C12H16F2N6/c1-7-2-5-10(18)20(6-7)11(19)12(13,14)8(15)3-4-9(16)17/h2-6,18-19H,15-17H2,1H3/b8-3-,18-10+,19-11+ |
| InChIKey | CWGAZDCNHTUHOO-KNGBRMKKSA-N |
| XLogP | 0.34 |
| TPSA | 130.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|