C20H19N3O7 — CID 154483445
2-[3-[3-(4-ethoxycarbonyl-3-nitroanilino)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]acetic acid (PubChem CID 154483445) has the molecular formula C20H19N3O7 and a molecular weight of 413.39 g/mol. Its IUPAC name is 2-[3-[3-(4-ethoxycarbonyl-3-nitroanilino)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]acetic acid.
| Compound Name | 2-[3-[3-(4-ethoxycarbonyl-3-nitroanilino)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 154483445 |
| Molecular Formula | C20H19N3O7 |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 2-[3-[3-(4-ethoxycarbonyl-3-nitroanilino)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]acetic acid |
| SMILES | CCOC(=O)c1ccc(Nc2cccc(C3=NOC(CC(=O)O)C3)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H19N3O7/c1-2-29-20(26)16-7-6-14(9-18(16)23(27)28)21-13-5-3-4-12(8-13)17-10-15(30-22-17)11-19(24)25/h3-9,15,21H,2,10-11H2,1H3,(H,24,25) |
| InChIKey | RLQUDBPHTFCDER-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 140.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|