About (9-hydrazinyl-1,10-phenanthrolin-2-yl)hydrazine
(9-hydrazinyl-1,10-phenanthrolin-2-yl)hydrazine (PubChem CID 15448479) has the molecular formula C12H12N6
and a molecular weight of 240.27 g/mol. Its IUPAC name is (9-hydrazinyl-1,10-phenanthrolin-2-yl)hydrazine.
Molecular Properties
| Compound Name | (9-hydrazinyl-1,10-phenanthrolin-2-yl)hydrazine |
| PubChem CID | 15448479 |
| Molecular Formula | C12H12N6 |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | (9-hydrazinyl-1,10-phenanthrolin-2-yl)hydrazine |
| SMILES | NNc1ccc2ccc3ccc(NN)nc3c2n1 |
| InChI | InChI=1S/C12H12N6/c13-17-9-5-3-7-1-2-8-4-6-10(18-14)16-12(8)11(7)15-9/h1-6H,13-14H2,(H,15,17)(H,16,18) |
| InChIKey | NAELFNRXVZQGHH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze (9-hydrazinyl-1,10-phenanthrolin-2-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9-hydrazinyl-1,10-phenanthrolin-2-yl)hydrazine?
The IUPAC name of (9-hydrazinyl-1,10-phenanthrolin-2-yl)hydrazine (CID 15448479) is (9-hydrazinyl-1,10-phenanthrolin-2-yl)hydrazine.
What is the SMILES notation for (9-hydrazinyl-1,10-phenanthrolin-2-yl)hydrazine?
The canonical SMILES for (9-hydrazinyl-1,10-phenanthrolin-2-yl)hydrazine is NNc1ccc2ccc3ccc(NN)nc3c2n1.
What is the InChIKey of (9-hydrazinyl-1,10-phenanthrolin-2-yl)hydrazine?
The InChIKey is NAELFNRXVZQGHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N6/c13-17-9-5-3-7-1-2-8-4-6-10(18-14)16-12(8)11(7)15-9/h1-6H,13-14H2,(H,15,17)(H,16,18).
What are the key properties of (9-hydrazinyl-1,10-phenanthrolin-2-yl)hydrazine?
(9-hydrazinyl-1,10-phenanthrolin-2-yl)hydrazine has a molecular weight of 240.27 g/mol, XLogP of 1.35, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (9-hydrazinyl-1,10-phenanthrolin-2-yl)hydrazine is sourced from PubChem (CID 15448479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).