C18H21N5O — CID 154485075
7-methoxy-4-N'-(2-phenylcyclopropyl)-1H-quinazoline-4,4,6-triamine (PubChem CID 154485075) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is 7-methoxy-4-N'-(2-phenylcyclopropyl)-1H-quinazoline-4,4,6-triamine.
| Compound Name | 7-methoxy-4-N'-(2-phenylcyclopropyl)-1H-quinazoline-4,4,6-triamine |
|---|---|
| PubChem CID | 154485075 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 7-methoxy-4-N'-(2-phenylcyclopropyl)-1H-quinazoline-4,4,6-triamine |
| SMILES | COc1cc2c(cc1N)C(N)(NC1CC1c1ccccc1)N=CN2 |
| InChI | InChI=1S/C18H21N5O/c1-24-17-9-16-13(8-14(17)19)18(20,22-10-21-16)23-15-7-12(15)11-5-3-2-4-6-11/h2-6,8-10,12,15,23H,7,19-20H2,1H3,(H,21,22) |
| InChIKey | GJBSDMPIABKVSV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|