C12H18O4 — CID 15448603
methyl (4aS,8aR)-5,5-dimethyl-3,4,4a,8a-tetrahydro-2H-pyrano[3,2-c]pyran-7-carboxylate (PubChem CID 15448603) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is methyl (4aS,8aR)-5,5-dimethyl-3,4,4a,8a-tetrahydro-2H-pyrano[3,2-c]pyran-7-carboxylate.
| Compound Name | methyl (4aS,8aR)-5,5-dimethyl-3,4,4a,8a-tetrahydro-2H-pyrano[3,2-c]pyran-7-carboxylate |
|---|---|
| PubChem CID | 15448603 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | methyl (4aS,8aR)-5,5-dimethyl-3,4,4a,8a-tetrahydro-2H-pyrano[3,2-c]pyran-7-carboxylate |
| SMILES | COC(=O)C1=C[C@H]2OCCC[C@@H]2C(C)(C)O1 |
| InChI | InChI=1S/C12H18O4/c1-12(2)8-5-4-6-15-9(8)7-10(16-12)11(13)14-3/h7-9H,4-6H2,1-3H3/t8-,9+/m0/s1 |
| InChIKey | BUYRILHDGUUBAI-DTWKUNHWSA-N |
| XLogP | 1.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |