C5H20Si5 — CID 154486675
1,2,3,4,5-pentamethylpentasilolane (PubChem CID 154486675) has the molecular formula C5H20Si5 and a molecular weight of 220.64 g/mol. Its IUPAC name is 1,2,3,4,5-pentamethylpentasilolane.
| Compound Name | 1,2,3,4,5-pentamethylpentasilolane |
|---|---|
| PubChem CID | 154486675 |
| Molecular Formula | C5H20Si5 |
| Molecular Weight | 220.64 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | 1,2,3,4,5-pentamethylpentasilolane |
| SMILES | C[SiH]1[SiH](C)[SiH](C)[SiH](C)[SiH]1C |
| InChI | InChI=1S/C5H20Si5/c1-6-7(2)9(4)10(5)8(6)3/h6-10H,1-5H3 |
| InChIKey | NXOSPQPFRASBJL-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.64 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|