About 1,2-diiodoethane-1,2-diol
1,2-diiodoethane-1,2-diol (PubChem CID 154486682) has the molecular formula C2H4I2O2
and a molecular weight of 313.86 g/mol. Its IUPAC name is 1,2-diiodoethane-1,2-diol.
Molecular Properties
| Compound Name | 1,2-diiodoethane-1,2-diol |
| PubChem CID | 154486682 |
| Molecular Formula | C2H4I2O2 |
| Molecular Weight | 313.86 g/mol |
| Exact Mass | 313.83 |
| IUPAC Name | 1,2-diiodoethane-1,2-diol |
| SMILES | OC(I)C(O)I |
| InChI | InChI=1S/C2H4I2O2/c3-1(5)2(4)6/h1-2,5-6H |
| InChIKey | WJYXMOGWJLAQQL-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.86 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,2-diiodoethane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diiodoethane-1,2-diol?
The IUPAC name of 1,2-diiodoethane-1,2-diol (CID 154486682) is 1,2-diiodoethane-1,2-diol.
What is the SMILES notation for 1,2-diiodoethane-1,2-diol?
The canonical SMILES for 1,2-diiodoethane-1,2-diol is OC(I)C(O)I.
What is the InChIKey of 1,2-diiodoethane-1,2-diol?
The InChIKey is WJYXMOGWJLAQQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4I2O2/c3-1(5)2(4)6/h1-2,5-6H.
What are the key properties of 1,2-diiodoethane-1,2-diol?
1,2-diiodoethane-1,2-diol has a molecular weight of 313.86 g/mol, XLogP of 0.49, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diiodoethane-1,2-diol is sourced from PubChem (CID 154486682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).