About 2-(1H-pyrrol-2-yl)-1,3-dihydropyrazole
2-(1H-pyrrol-2-yl)-1,3-dihydropyrazole (PubChem CID 154487442) has the molecular formula C7H9N3
and a molecular weight of 135.17 g/mol. Its IUPAC name is 2-(1H-pyrrol-2-yl)-1,3-dihydropyrazole.
Molecular Properties
| Compound Name | 2-(1H-pyrrol-2-yl)-1,3-dihydropyrazole |
| PubChem CID | 154487442 |
| Molecular Formula | C7H9N3 |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | 2-(1H-pyrrol-2-yl)-1,3-dihydropyrazole |
| SMILES | C1=CNN(c2ccc[nH]2)C1 |
| InChI | InChI=1S/C7H9N3/c1-3-7(8-4-1)10-6-2-5-9-10/h1-5,8-9H,6H2 |
| InChIKey | BOKWPYAZRRSGKA-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1H-pyrrol-2-yl)-1,3-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-pyrrol-2-yl)-1,3-dihydropyrazole?
The IUPAC name of 2-(1H-pyrrol-2-yl)-1,3-dihydropyrazole (CID 154487442) is 2-(1H-pyrrol-2-yl)-1,3-dihydropyrazole.
What is the SMILES notation for 2-(1H-pyrrol-2-yl)-1,3-dihydropyrazole?
The canonical SMILES for 2-(1H-pyrrol-2-yl)-1,3-dihydropyrazole is C1=CNN(c2ccc[nH]2)C1.
What is the InChIKey of 2-(1H-pyrrol-2-yl)-1,3-dihydropyrazole?
The InChIKey is BOKWPYAZRRSGKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3/c1-3-7(8-4-1)10-6-2-5-9-10/h1-5,8-9H,6H2.
What are the key properties of 2-(1H-pyrrol-2-yl)-1,3-dihydropyrazole?
2-(1H-pyrrol-2-yl)-1,3-dihydropyrazole has a molecular weight of 135.17 g/mol, XLogP of 0.85, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-pyrrol-2-yl)-1,3-dihydropyrazole is sourced from PubChem (CID 154487442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).