About N-(1-chloro-6-hydroxycyclohexa-2,4-dien-1-yl)acetamide
N-(1-chloro-6-hydroxycyclohexa-2,4-dien-1-yl)acetamide (PubChem CID 154487622) has the molecular formula C8H10ClNO2
and a molecular weight of 187.63 g/mol. Its IUPAC name is N-(1-chloro-6-hydroxycyclohexa-2,4-dien-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(1-chloro-6-hydroxycyclohexa-2,4-dien-1-yl)acetamide |
| PubChem CID | 154487622 |
| Molecular Formula | C8H10ClNO2 |
| Molecular Weight | 187.63 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | N-(1-chloro-6-hydroxycyclohexa-2,4-dien-1-yl)acetamide |
| SMILES | CC(=O)NC1(Cl)C=CC=CC1O |
| InChI | InChI=1S/C8H10ClNO2/c1-6(11)10-8(9)5-3-2-4-7(8)12/h2-5,7,12H,1H3,(H,10,11) |
| InChIKey | OIIMXLJPBTXOCE-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.63 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-(1-chloro-6-hydroxycyclohexa-2,4-dien-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-chloro-6-hydroxycyclohexa-2,4-dien-1-yl)acetamide?
The IUPAC name of N-(1-chloro-6-hydroxycyclohexa-2,4-dien-1-yl)acetamide (CID 154487622) is N-(1-chloro-6-hydroxycyclohexa-2,4-dien-1-yl)acetamide.
What is the SMILES notation for N-(1-chloro-6-hydroxycyclohexa-2,4-dien-1-yl)acetamide?
The canonical SMILES for N-(1-chloro-6-hydroxycyclohexa-2,4-dien-1-yl)acetamide is CC(=O)NC1(Cl)C=CC=CC1O.
What is the InChIKey of N-(1-chloro-6-hydroxycyclohexa-2,4-dien-1-yl)acetamide?
The InChIKey is OIIMXLJPBTXOCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClNO2/c1-6(11)10-8(9)5-3-2-4-7(8)12/h2-5,7,12H,1H3,(H,10,11).
What are the key properties of N-(1-chloro-6-hydroxycyclohexa-2,4-dien-1-yl)acetamide?
N-(1-chloro-6-hydroxycyclohexa-2,4-dien-1-yl)acetamide has a molecular weight of 187.63 g/mol, XLogP of 0.54, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-chloro-6-hydroxycyclohexa-2,4-dien-1-yl)acetamide is sourced from PubChem (CID 154487622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).