About 5-cyclohexyltriazolo[4,5-a][3]benzazepine
5-cyclohexyltriazolo[4,5-a][3]benzazepine (PubChem CID 154487701) has the molecular formula C16H16N4
and a molecular weight of 264.33 g/mol. Its IUPAC name is 5-cyclohexyltriazolo[4,5-a][3]benzazepine.
Molecular Properties
| Compound Name | 5-cyclohexyltriazolo[4,5-a][3]benzazepine |
| PubChem CID | 154487701 |
| Molecular Formula | C16H16N4 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 5-cyclohexyltriazolo[4,5-a][3]benzazepine |
| SMILES | c1ccc2c3nnnc-3nc(C3CCCCC3)cc2c1 |
| InChI | InChI=1S/C16H16N4/c1-2-6-11(7-3-1)14-10-12-8-4-5-9-13(12)15-16(17-14)19-20-18-15/h4-5,8-11H,1-3,6-7H2 |
| InChIKey | QMPZTONWRGUNJX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-cyclohexyltriazolo[4,5-a][3]benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclohexyltriazolo[4,5-a][3]benzazepine?
The IUPAC name of 5-cyclohexyltriazolo[4,5-a][3]benzazepine (CID 154487701) is 5-cyclohexyltriazolo[4,5-a][3]benzazepine.
What is the SMILES notation for 5-cyclohexyltriazolo[4,5-a][3]benzazepine?
The canonical SMILES for 5-cyclohexyltriazolo[4,5-a][3]benzazepine is c1ccc2c3nnnc-3nc(C3CCCCC3)cc2c1.
What is the InChIKey of 5-cyclohexyltriazolo[4,5-a][3]benzazepine?
The InChIKey is QMPZTONWRGUNJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4/c1-2-6-11(7-3-1)14-10-12-8-4-5-9-13(12)15-16(17-14)19-20-18-15/h4-5,8-11H,1-3,6-7H2.
What are the key properties of 5-cyclohexyltriazolo[4,5-a][3]benzazepine?
5-cyclohexyltriazolo[4,5-a][3]benzazepine has a molecular weight of 264.33 g/mol, XLogP of 3.57, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohexyltriazolo[4,5-a][3]benzazepine is sourced from PubChem (CID 154487701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).