C21H26O2 — CID 154489016
(8'R,9'S,13'S,14'S)-13'-methylspiro[3H-furan-2,17'-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene]-3'-ol (PubChem CID 154489016) has the molecular formula C21H26O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is (8'R,9'S,13'S,14'S)-13'-methylspiro[3H-furan-2,17'-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene]-3'-ol.
| Compound Name | (8'R,9'S,13'S,14'S)-13'-methylspiro[3H-furan-2,17'-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene]-3'-ol |
|---|---|
| PubChem CID | 154489016 |
| Molecular Formula | C21H26O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | (8'R,9'S,13'S,14'S)-13'-methylspiro[3H-furan-2,17'-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene]-3'-ol |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CCC21CC=CO1 |
| InChI | InChI=1S/C21H26O2/c1-20-10-7-17-16-6-4-15(22)13-14(16)3-5-18(17)19(20)8-11-21(20)9-2-12-23-21/h2,4,6,12-13,17-19,22H,3,5,7-11H2,1H3/t17-,18-,19+,20+,21?/m1/s1 |
| InChIKey | JZEUCNCIVXRHDM-AUGMSIGLSA-N |
| XLogP | 4.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |