C21H25BrClN3O2 — CID 154489218
7-bromo-3-[(4-chlorophenyl)methyl]-4-(3-methylbutyl)-9-nitro-1,2,3,5-tetrahydro-1,4-benzodiazepine (PubChem CID 154489218) has the molecular formula C21H25BrClN3O2 and a molecular weight of 466.81 g/mol. Its IUPAC name is 7-bromo-3-[(4-chlorophenyl)methyl]-4-(3-methylbutyl)-9-nitro-1,2,3,5-tetrahydro-1,4-benzodiazepine.
| Compound Name | 7-bromo-3-[(4-chlorophenyl)methyl]-4-(3-methylbutyl)-9-nitro-1,2,3,5-tetrahydro-1,4-benzodiazepine |
|---|---|
| PubChem CID | 154489218 |
| Molecular Formula | C21H25BrClN3O2 |
| Molecular Weight | 466.81 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | 7-bromo-3-[(4-chlorophenyl)methyl]-4-(3-methylbutyl)-9-nitro-1,2,3,5-tetrahydro-1,4-benzodiazepine |
| SMILES | CC(C)CCN1Cc2cc(Br)cc([N+](=O)[O-])c2NCC1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H25BrClN3O2/c1-14(2)7-8-25-13-16-10-17(22)11-20(26(27)28)21(16)24-12-19(25)9-15-3-5-18(23)6-4-15/h3-6,10-11,14,19,24H,7-9,12-13H2,1-2H3 |
| InChIKey | YBSHSGKFELVVJH-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.81 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|