C8H15NO2 — CID 154489274
2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole-1,3-diol (PubChem CID 154489274) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole-1,3-diol.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole-1,3-diol |
|---|---|
| PubChem CID | 154489274 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole-1,3-diol |
| SMILES | OC1NC(O)C2CCCCC12 |
| InChI | InChI=1S/C8H15NO2/c10-7-5-3-1-2-4-6(5)8(11)9-7/h5-11H,1-4H2 |
| InChIKey | QJQVTEBTHHYVMG-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |