C7H8N2O3 — CID 154489447
6,7,8,8a-tetrahydroimidazo[1,5-a]pyridine-1,3,5-trione (PubChem CID 154489447) has the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. Its IUPAC name is 6,7,8,8a-tetrahydroimidazo[1,5-a]pyridine-1,3,5-trione.
| Compound Name | 6,7,8,8a-tetrahydroimidazo[1,5-a]pyridine-1,3,5-trione |
|---|---|
| PubChem CID | 154489447 |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | 6,7,8,8a-tetrahydroimidazo[1,5-a]pyridine-1,3,5-trione |
| SMILES | O=C1NC(=O)N2C(=O)CCCC12 |
| InChI | InChI=1S/C7H8N2O3/c10-5-3-1-2-4-6(11)8-7(12)9(4)5/h4H,1-3H2,(H,8,11,12) |
| InChIKey | QQDAQYPICPWNKI-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|