About tridecan-2-ol
tridecan-2-ol (PubChem CID 15449) has the molecular formula C13H28O
and a molecular weight of 200.37 g/mol. Its IUPAC name is tridecan-2-ol.
Molecular Properties
| Compound Name | tridecan-2-ol |
| PubChem CID | 15449 |
| Molecular Formula | C13H28O |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.21 |
| IUPAC Name | tridecan-2-ol |
| SMILES | CCCCCCCCCCCC(C)O |
| InChI | InChI=1S/C13H28O/c1-3-4-5-6-7-8-9-10-11-12-13(2)14/h13-14H,3-12H2,1-2H3 |
| InChIKey | HKOLRKVMHVYNGG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tridecan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tridecan-2-ol?
The IUPAC name of tridecan-2-ol (CID 15449) is tridecan-2-ol.
What is the SMILES notation for tridecan-2-ol?
The canonical SMILES for tridecan-2-ol is CCCCCCCCCCCC(C)O.
What is the InChIKey of tridecan-2-ol?
The InChIKey is HKOLRKVMHVYNGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28O/c1-3-4-5-6-7-8-9-10-11-12-13(2)14/h13-14H,3-12H2,1-2H3.
What are the key properties of tridecan-2-ol?
tridecan-2-ol has a molecular weight of 200.37 g/mol, XLogP of 4.29, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tridecan-2-ol is sourced from PubChem (CID 15449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).