C21H33N3O — CID 154490639
N-(4-aminophenyl)-2-[3-(cyclohexylmethyl)piperidin-1-yl]-N-methylacetamide (PubChem CID 154490639) has the molecular formula C21H33N3O and a molecular weight of 343.51 g/mol. Its IUPAC name is N-(4-aminophenyl)-2-[3-(cyclohexylmethyl)piperidin-1-yl]-N-methylacetamide.
| Compound Name | N-(4-aminophenyl)-2-[3-(cyclohexylmethyl)piperidin-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 154490639 |
| Molecular Formula | C21H33N3O |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.26 |
| IUPAC Name | N-(4-aminophenyl)-2-[3-(cyclohexylmethyl)piperidin-1-yl]-N-methylacetamide |
| SMILES | CN(C(=O)CN1CCCC(CC2CCCCC2)C1)c1ccc(N)cc1 |
| InChI | InChI=1S/C21H33N3O/c1-23(20-11-9-19(22)10-12-20)21(25)16-24-13-5-8-18(15-24)14-17-6-3-2-4-7-17/h9-12,17-18H,2-8,13-16,22H2,1H3 |
| InChIKey | ACVCMUZHOXTZGO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|