About 4-piperidin-4-yl-3H-pyridine-2,4-diamine
4-piperidin-4-yl-3H-pyridine-2,4-diamine (PubChem CID 154490813) has the molecular formula C10H18N4
and a molecular weight of 194.28 g/mol. Its IUPAC name is 4-piperidin-4-yl-3H-pyridine-2,4-diamine.
Molecular Properties
| Compound Name | 4-piperidin-4-yl-3H-pyridine-2,4-diamine |
| PubChem CID | 154490813 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 4-piperidin-4-yl-3H-pyridine-2,4-diamine |
| SMILES | NC1=NC=CC(N)(C2CCNCC2)C1 |
| InChI | InChI=1S/C10H18N4/c11-9-7-10(12,3-6-14-9)8-1-4-13-5-2-8/h3,6,8,13H,1-2,4-5,7,12H2,(H2,11,14) |
| InChIKey | GQCUQZWBOQZVQM-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-piperidin-4-yl-3H-pyridine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-piperidin-4-yl-3H-pyridine-2,4-diamine?
The IUPAC name of 4-piperidin-4-yl-3H-pyridine-2,4-diamine (CID 154490813) is 4-piperidin-4-yl-3H-pyridine-2,4-diamine.
What is the SMILES notation for 4-piperidin-4-yl-3H-pyridine-2,4-diamine?
The canonical SMILES for 4-piperidin-4-yl-3H-pyridine-2,4-diamine is NC1=NC=CC(N)(C2CCNCC2)C1.
What is the InChIKey of 4-piperidin-4-yl-3H-pyridine-2,4-diamine?
The InChIKey is GQCUQZWBOQZVQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4/c11-9-7-10(12,3-6-14-9)8-1-4-13-5-2-8/h3,6,8,13H,1-2,4-5,7,12H2,(H2,11,14).
What are the key properties of 4-piperidin-4-yl-3H-pyridine-2,4-diamine?
4-piperidin-4-yl-3H-pyridine-2,4-diamine has a molecular weight of 194.28 g/mol, XLogP of -0.04, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-piperidin-4-yl-3H-pyridine-2,4-diamine is sourced from PubChem (CID 154490813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).