C3H9Cl3Si3 — CID 154490824
1,3,5-trichloro-1,3,5-trisilinane (PubChem CID 154490824) has the molecular formula C3H9Cl3Si3 and a molecular weight of 235.72 g/mol. Its IUPAC name is 1,3,5-trichloro-1,3,5-trisilinane.
| Compound Name | 1,3,5-trichloro-1,3,5-trisilinane |
|---|---|
| PubChem CID | 154490824 |
| Molecular Formula | C3H9Cl3Si3 |
| Molecular Weight | 235.72 g/mol |
| Exact Mass | 233.91 |
| IUPAC Name | 1,3,5-trichloro-1,3,5-trisilinane |
| SMILES | Cl[SiH]1C[SiH](Cl)C[SiH](Cl)C1 |
| InChI | InChI=1S/C3H9Cl3Si3/c4-7-1-8(5)3-9(6)2-7/h7-9H,1-3H2 |
| InChIKey | XGGQQNJLLHWJPB-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.72 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|