About 3-isocyanatopropyl carbamate
3-isocyanatopropyl carbamate (PubChem CID 154491436) has the molecular formula C5H8N2O3
and a molecular weight of 144.13 g/mol. Its IUPAC name is 3-isocyanatopropyl carbamate.
Molecular Properties
| Compound Name | 3-isocyanatopropyl carbamate |
| PubChem CID | 154491436 |
| Molecular Formula | C5H8N2O3 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.05 |
| IUPAC Name | 3-isocyanatopropyl carbamate |
| SMILES | NC(=O)OCCCN=C=O |
| InChI | InChI=1S/C5H8N2O3/c6-5(9)10-3-1-2-7-4-8/h1-3H2,(H2,6,9) |
| InChIKey | KZTBNSSOJJAUSH-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 3-isocyanatopropyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-isocyanatopropyl carbamate?
The IUPAC name of 3-isocyanatopropyl carbamate (CID 154491436) is 3-isocyanatopropyl carbamate.
What is the SMILES notation for 3-isocyanatopropyl carbamate?
The canonical SMILES for 3-isocyanatopropyl carbamate is NC(=O)OCCCN=C=O.
What is the InChIKey of 3-isocyanatopropyl carbamate?
The InChIKey is KZTBNSSOJJAUSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O3/c6-5(9)10-3-1-2-7-4-8/h1-3H2,(H2,6,9).
What are the key properties of 3-isocyanatopropyl carbamate?
3-isocyanatopropyl carbamate has a molecular weight of 144.13 g/mol, XLogP of -0.19, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-isocyanatopropyl carbamate is sourced from PubChem (CID 154491436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).