C32H25ClF3NO3 — CID 15449182
ethyl 4-[5-chloro-2-(tritylamino)phenyl]-5,5,5-trifluoro-4-hydroxypent-2-ynoate (PubChem CID 15449182) has the molecular formula C32H25ClF3NO3 and a molecular weight of 564.00 g/mol. Its IUPAC name is ethyl 4-[5-chloro-2-(tritylamino)phenyl]-5,5,5-trifluoro-4-hydroxypent-2-ynoate.
| Compound Name | ethyl 4-[5-chloro-2-(tritylamino)phenyl]-5,5,5-trifluoro-4-hydroxypent-2-ynoate |
|---|---|
| PubChem CID | 15449182 |
| Molecular Formula | C32H25ClF3NO3 |
| Molecular Weight | 564.00 g/mol |
| Exact Mass | 563.15 |
| IUPAC Name | ethyl 4-[5-chloro-2-(tritylamino)phenyl]-5,5,5-trifluoro-4-hydroxypent-2-ynoate |
| SMILES | CCOC(=O)C#CC(O)(c1cc(Cl)ccc1NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C32H25ClF3NO3/c1-2-40-29(38)20-21-30(39,32(34,35)36)27-22-26(33)18-19-28(27)37-31(23-12-6-3-7-13-23,24-14-8-4-9-15-24)25-16-10-5-11-17-25/h3-19,22,37,39H,2H2,1H3 |
| InChIKey | XWJCTKTVJIBVCL-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.00 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|