C33H29ClF3NO — CID 15449184
2-[5-chloro-2-(tritylamino)phenyl]-1,1,1-trifluorooct-3-yn-2-ol (PubChem CID 15449184) has the molecular formula C33H29ClF3NO and a molecular weight of 548.05 g/mol. Its IUPAC name is 2-[5-chloro-2-(tritylamino)phenyl]-1,1,1-trifluorooct-3-yn-2-ol.
| Compound Name | 2-[5-chloro-2-(tritylamino)phenyl]-1,1,1-trifluorooct-3-yn-2-ol |
|---|---|
| PubChem CID | 15449184 |
| Molecular Formula | C33H29ClF3NO |
| Molecular Weight | 548.05 g/mol |
| Exact Mass | 547.19 |
| IUPAC Name | 2-[5-chloro-2-(tritylamino)phenyl]-1,1,1-trifluorooct-3-yn-2-ol |
| SMILES | CCCCC#CC(O)(c1cc(Cl)ccc1NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C33H29ClF3NO/c1-2-3-4-14-23-31(39,33(35,36)37)29-24-28(34)21-22-30(29)38-32(25-15-8-5-9-16-25,26-17-10-6-11-18-26)27-19-12-7-13-20-27/h5-13,15-22,24,38-39H,2-4H2,1H3 |
| InChIKey | GITBVGOUNOCWOV-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.05 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|